C30H44O5 — CID 102131645
(Z)-9-[(1R,4bR)-1,3,4b,8,8-pentamethyl-2,7-dioxo-5,6,8a,9,10,10a-hexahydro-4aH-phenanthren-1-yl]-2,6-dimethyl-7-oxonon-2-enoic acid (PubChem CID 102131645) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (Z)-9-[(1R,4bR)-1,3,4b,8,8-pentamethyl-2,7-dioxo-5,6,8a,9,10,10a-hexahydro-4aH-phenanthren-1-yl]-2,6-dimethyl-7-oxonon-2-enoic acid.
| Compound Name | (Z)-9-[(1R,4bR)-1,3,4b,8,8-pentamethyl-2,7-dioxo-5,6,8a,9,10,10a-hexahydro-4aH-phenanthren-1-yl]-2,6-dimethyl-7-oxonon-2-enoic acid |
|---|---|
| PubChem CID | 102131645 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (Z)-9-[(1R,4bR)-1,3,4b,8,8-pentamethyl-2,7-dioxo-5,6,8a,9,10,10a-hexahydro-4aH-phenanthren-1-yl]-2,6-dimethyl-7-oxonon-2-enoic acid |
| SMILES | CC1=CC2C(CCC3C(C)(C)C(=O)CC[C@]23C)[C@@](C)(CCC(=O)C(C)CC/C=C(/C)C(=O)O)C1=O |
| InChI | InChI=1S/C30H44O5/c1-18(9-8-10-19(2)27(34)35)23(31)13-15-30(7)21-11-12-24-28(4,5)25(32)14-16-29(24,6)22(21)17-20(3)26(30)33/h10,17-18,21-22,24H,8-9,11-16H2,1-7H3,(H,34,35)/b19-10-/t18?,21?,22?,24?,29-,30-/m1/s1 |
| InChIKey | MLHJCXGRMMPULD-BBCJKDJXSA-N |
| XLogP | 6.36 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|