C32H52O — CID 162936084
(5S,8R,10R,13R,14S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-5,6,6-trimethylhept-4-en-2-yl]-1,2,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 162936084) has the molecular formula C32H52O and a molecular weight of 452.77 g/mol. Its IUPAC name is (5S,8R,10R,13R,14S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-5,6,6-trimethylhept-4-en-2-yl]-1,2,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,8R,10R,13R,14S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-5,6,6-trimethylhept-4-en-2-yl]-1,2,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162936084 |
| Molecular Formula | C32H52O |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 452.40 |
| IUPAC Name | (5S,8R,10R,13R,14S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-5,6,6-trimethylhept-4-en-2-yl]-1,2,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@H]3CC[C@@H]4C(C)(C)C(=O)CC[C@@]4(C)C3=CC[C@]12C)C(C)(C)C |
| InChI | InChI=1S/C32H52O/c1-21(11-12-22(2)28(3,4)5)23-15-19-32(10)25-13-14-26-29(6,7)27(33)17-18-30(26,8)24(25)16-20-31(23,32)9/h12,16,21,23,25-26H,11,13-15,17-20H2,1-10H3/t21-,23-,25+,26-,30+,31-,32+/m1/s1 |
| InChIKey | TTWBOFXFIFTVOA-PGMZRGCSSA-N |
| XLogP | 9.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|