C20H12Cl2FN3 — CID 134817436
N-(2,5-dichlorophenyl)-2-(4-fluorophenyl)quinazolin-4-amine (PubChem CID 134817436) has the molecular formula C20H12Cl2FN3 and a molecular weight of 384.24 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(4-fluorophenyl)quinazolin-4-amine.
| Compound Name | N-(2,5-dichlorophenyl)-2-(4-fluorophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 134817436 |
| Molecular Formula | C20H12Cl2FN3 |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(4-fluorophenyl)quinazolin-4-amine |
| SMILES | Fc1ccc(-c2nc(Nc3cc(Cl)ccc3Cl)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C20H12Cl2FN3/c21-13-7-10-16(22)18(11-13)25-20-15-3-1-2-4-17(15)24-19(26-20)12-5-8-14(23)9-6-12/h1-11H,(H,24,25,26) |
| InChIKey | SSVNBIVEPWFUMU-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |