C6H4Br2FNO — CID 134818539
(2,5-dibromo-3-fluoro-4-pyridinyl)methanol (PubChem CID 134818539) has the molecular formula C6H4Br2FNO and a molecular weight of 284.91 g/mol. Its IUPAC name is (2,5-dibromo-3-fluoro-4-pyridinyl)methanol.
| Compound Name | (2,5-dibromo-3-fluoro-4-pyridinyl)methanol |
|---|---|
| PubChem CID | 134818539 |
| Molecular Formula | C6H4Br2FNO |
| Molecular Weight | 284.91 g/mol |
| Exact Mass | 282.86 |
| IUPAC Name | (2,5-dibromo-3-fluoro-4-pyridinyl)methanol |
| SMILES | OCc1c(Br)cnc(Br)c1F |
| InChI | InChI=1S/C6H4Br2FNO/c7-4-1-10-6(8)5(9)3(4)2-11/h1,11H,2H2 |
| InChIKey | YKIBEXBIIJKKAP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.91 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|