C5H3Br2FN2 — CID 135396297
2,5-dibromo-4-fluoropyridin-3-amine (PubChem CID 135396297) has the molecular formula C5H3Br2FN2 and a molecular weight of 269.90 g/mol. Its IUPAC name is 2,5-dibromo-4-fluoropyridin-3-amine.
| Compound Name | 2,5-dibromo-4-fluoropyridin-3-amine |
|---|---|
| PubChem CID | 135396297 |
| Molecular Formula | C5H3Br2FN2 |
| Molecular Weight | 269.90 g/mol |
| Exact Mass | 267.86 |
| IUPAC Name | 2,5-dibromo-4-fluoropyridin-3-amine |
| SMILES | Nc1c(Br)ncc(Br)c1F |
| InChI | InChI=1S/C5H3Br2FN2/c6-2-1-10-5(7)4(9)3(2)8/h1H,9H2 |
| InChIKey | QPOQPETUUILFAC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.90 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|