C7H3Br2N3 — CID 102025171
5,8-dibromopyrido[3,4-b]pyrazine (PubChem CID 102025171) has the molecular formula C7H3Br2N3 and a molecular weight of 288.93 g/mol. Its IUPAC name is 5,8-dibromopyrido[3,4-b]pyrazine.
| Compound Name | 5,8-dibromopyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 102025171 |
| Molecular Formula | C7H3Br2N3 |
| Molecular Weight | 288.93 g/mol |
| Exact Mass | 286.87 |
| IUPAC Name | 5,8-dibromopyrido[3,4-b]pyrazine |
| SMILES | Brc1cnc(Br)c2nccnc12 |
| InChI | InChI=1S/C7H3Br2N3/c8-4-3-12-7(9)6-5(4)10-1-2-11-6/h1-3H |
| InChIKey | WDIQZKROTCIZTP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.93 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|