C20H25N5O6S2 — CID 134820203
(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-(1H-indol-3-ylmethylcarbamothioylsulfanyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 134820203) has the molecular formula C20H25N5O6S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-(1H-indol-3-ylmethylcarbamothioylsulfanyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-(1H-indol-3-ylmethylcarbamothioylsulfanyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 134820203 |
| Molecular Formula | C20H25N5O6S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-(1H-indol-3-ylmethylcarbamothioylsulfanyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSC(=S)NCc1c[nH]c2ccccc12)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H25N5O6S2/c21-13(19(30)31)5-6-16(26)25-15(18(29)23-9-17(27)28)10-33-20(32)24-8-11-7-22-14-4-2-1-3-12(11)14/h1-4,7,13,15,22H,5-6,8-10,21H2,(H,23,29)(H,24,32)(H,25,26)(H,27,28)(H,30,31)/t13-,15-/m0/s1 |
| InChIKey | WJEGHYZNKDEWFC-ZFWWWQNUSA-N |
| XLogP | 0.15 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|