C15H24N4O6S2 — CID 172639986
2-amino-5-[[3-(but-3-enylcarbamothioylsulfanyl)-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 172639986) has the molecular formula C15H24N4O6S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-amino-5-[[3-(but-3-enylcarbamothioylsulfanyl)-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[3-(but-3-enylcarbamothioylsulfanyl)-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 172639986 |
| Molecular Formula | C15H24N4O6S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-amino-5-[[3-(but-3-enylcarbamothioylsulfanyl)-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | C=CCCNC(=S)SCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C15H24N4O6S2/c1-2-3-6-17-15(26)27-8-10(13(23)18-7-12(21)22)19-11(20)5-4-9(16)14(24)25/h2,9-10H,1,3-8,16H2,(H,17,26)(H,18,23)(H,19,20)(H,21,22)(H,24,25) |
| InChIKey | HMAQHCSMSNHSAW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|