C12H15N5O2S2 — CID 134823533
3-(2-methylthiophen-3-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide (PubChem CID 134823533) has the molecular formula C12H15N5O2S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-(2-methylthiophen-3-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide.
| Compound Name | 3-(2-methylthiophen-3-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134823533 |
| Molecular Formula | C12H15N5O2S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-(2-methylthiophen-3-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide |
| SMILES | Cc1sccc1-c1cccc(S(N)(=O)=O)c1C1NNNN1 |
| InChI | InChI=1S/C12H15N5O2S2/c1-7-8(5-6-20-7)9-3-2-4-10(21(13,18)19)11(9)12-14-16-17-15-12/h2-6,12,14-17H,1H3,(H2,13,18,19) |
| InChIKey | IUAHSFNSXNVZED-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |