C15H20N6O4S2 — CID 134823499
3-[4-(dimethylsulfamoyl)phenyl]-2-(tetrazolidin-5-yl)benzenesulfonamide (PubChem CID 134823499) has the molecular formula C15H20N6O4S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 3-[4-(dimethylsulfamoyl)phenyl]-2-(tetrazolidin-5-yl)benzenesulfonamide.
| Compound Name | 3-[4-(dimethylsulfamoyl)phenyl]-2-(tetrazolidin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134823499 |
| Molecular Formula | C15H20N6O4S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 3-[4-(dimethylsulfamoyl)phenyl]-2-(tetrazolidin-5-yl)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2cccc(S(N)(=O)=O)c2C2NNNN2)cc1 |
| InChI | InChI=1S/C15H20N6O4S2/c1-21(2)27(24,25)11-8-6-10(7-9-11)12-4-3-5-13(26(16,22)23)14(12)15-17-19-20-18-15/h3-9,15,17-20H,1-2H3,(H2,16,22,23) |
| InChIKey | JMILMKXAVZGQBU-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |