C13H18N4OS — CID 134824089
3-(2-propylsulfanylbenzimidazol-1-yl)propanehydrazide (PubChem CID 134824089) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-(2-propylsulfanylbenzimidazol-1-yl)propanehydrazide.
| Compound Name | 3-(2-propylsulfanylbenzimidazol-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 134824089 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-(2-propylsulfanylbenzimidazol-1-yl)propanehydrazide |
| SMILES | CCCSc1nc2ccccc2n1CCC(=O)NN |
| InChI | InChI=1S/C13H18N4OS/c1-2-9-19-13-15-10-5-3-4-6-11(10)17(13)8-7-12(18)16-14/h3-6H,2,7-9,14H2,1H3,(H,16,18) |
| InChIKey | GOPKHWKRKLTLJS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|