C23H25NO6 — CID 134831443
benzyl (3aR,5R,6S,6aR)-5-benzyl-6-formyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate (PubChem CID 134831443) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is benzyl (3aR,5R,6S,6aR)-5-benzyl-6-formyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate.
| Compound Name | benzyl (3aR,5R,6S,6aR)-5-benzyl-6-formyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 134831443 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | benzyl (3aR,5R,6S,6aR)-5-benzyl-6-formyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
| SMILES | CC1(C)O[C@@H]2[C@@H](OC=O)[C@@H](Cc3ccccc3)N(C(=O)OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C23H25NO6/c1-23(2)29-20-19(28-15-25)18(13-16-9-5-3-6-10-16)24(21(20)30-23)22(26)27-14-17-11-7-4-8-12-17/h3-12,15,18-21H,13-14H2,1-2H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | FBVWJGLCERALBP-PLACYPQZSA-N |
| XLogP | 3.27 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|