C11H12F6O10S2 — CID 134831447
ethyl 5-(trifluoromethylsulfonyloxy)-3-(trifluoromethylsulfonyloxymethyl)-2,7-dioxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 134831447) has the molecular formula C11H12F6O10S2 and a molecular weight of 482.33 g/mol. Its IUPAC name is ethyl 5-(trifluoromethylsulfonyloxy)-3-(trifluoromethylsulfonyloxymethyl)-2,7-dioxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | ethyl 5-(trifluoromethylsulfonyloxy)-3-(trifluoromethylsulfonyloxymethyl)-2,7-dioxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 134831447 |
| Molecular Formula | C11H12F6O10S2 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | ethyl 5-(trifluoromethylsulfonyloxy)-3-(trifluoromethylsulfonyloxymethyl)-2,7-dioxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CCOC(=O)C12CC(OS(=O)(=O)C(F)(F)F)C(O1)C(COS(=O)(=O)C(F)(F)F)O2 |
| InChI | InChI=1S/C11H12F6O10S2/c1-2-23-8(18)9-3-5(27-29(21,22)11(15,16)17)7(26-9)6(25-9)4-24-28(19,20)10(12,13)14/h5-7H,2-4H2,1H3 |
| InChIKey | CNOYTRBOQUMZHA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|