C26H31F3O6 — CID 134832023
ethyl (3R)-2,2-dimethyl-5-phenylmethoxy-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypentanoate (PubChem CID 134832023) has the molecular formula C26H31F3O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is ethyl (3R)-2,2-dimethyl-5-phenylmethoxy-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypentanoate.
| Compound Name | ethyl (3R)-2,2-dimethyl-5-phenylmethoxy-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypentanoate |
|---|---|
| PubChem CID | 134832023 |
| Molecular Formula | C26H31F3O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | ethyl (3R)-2,2-dimethyl-5-phenylmethoxy-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypentanoate |
| SMILES | CCOC(=O)C(C)(C)[C@@H](CCOCc1ccccc1)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C26H31F3O6/c1-5-34-22(30)24(2,3)21(16-17-33-18-19-12-8-6-9-13-19)35-23(31)25(32-4,26(27,28)29)20-14-10-7-11-15-20/h6-15,21H,5,16-18H2,1-4H3/t21-,25+/m1/s1 |
| InChIKey | RILHGZORKANWFC-BWKNWUBXSA-N |
| XLogP | 5.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|