C15H25+ — CID 134832503
(3aR,9Z)-2,2,5,9-tetramethyl-3,3a,4,6,7,8-hexahydro-1H-cyclopenta[8]annulen-5-ylium (PubChem CID 134832503) has the molecular formula C15H25+ and a molecular weight of 205.36 g/mol. Its IUPAC name is (3aR,9Z)-2,2,5,9-tetramethyl-3,3a,4,6,7,8-hexahydro-1H-cyclopenta[8]annulen-5-ylium.
| Compound Name | (3aR,9Z)-2,2,5,9-tetramethyl-3,3a,4,6,7,8-hexahydro-1H-cyclopenta[8]annulen-5-ylium |
|---|---|
| PubChem CID | 134832503 |
| Molecular Formula | C15H25+ |
| Molecular Weight | 205.36 g/mol |
| Exact Mass | 205.20 |
| IUPAC Name | (3aR,9Z)-2,2,5,9-tetramethyl-3,3a,4,6,7,8-hexahydro-1H-cyclopenta[8]annulen-5-ylium |
| SMILES | C/C1=C2\CC(C)(C)C[C@H]2C[C+](C)CCC1 |
| InChI | InChI=1S/C15H25/c1-11-6-5-7-12(2)14-10-15(3,4)9-13(14)8-11/h13H,5-10H2,1-4H3/q+1/b14-12-/t13-/m1/s1 |
| InChIKey | CMCVRVNNKAGCKA-NXXVSJRMSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|