C29H43NO5Si — CID 134832624
pentan-3-yl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 134832624) has the molecular formula C29H43NO5Si and a molecular weight of 513.75 g/mol. Its IUPAC name is pentan-3-yl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | pentan-3-yl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 134832624 |
| Molecular Formula | C29H43NO5Si |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | pentan-3-yl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CCC(CC)OC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H43NO5Si/c1-8-24(9-2)34-27(31)26(35-36(6,7)29(3,4)5)25(20-22-16-12-10-13-17-22)30-28(32)33-21-23-18-14-11-15-19-23/h10-19,24-26H,8-9,20-21H2,1-7H3,(H,30,32)/t25-,26-/m1/s1 |
| InChIKey | ATLLUSAWSXNEME-CLJLJLNGSA-N |
| XLogP | 6.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|