C20H15N3O2 — CID 134833852
methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate (PubChem CID 134833852) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate.
| Compound Name | methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 134833852 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)nc2c1ncn2-c1ccccc1 |
| InChI | InChI=1S/C20H15N3O2/c1-25-20(24)16-12-17(14-8-4-2-5-9-14)22-19-18(16)21-13-23(19)15-10-6-3-7-11-15/h2-13H,1H3 |
| InChIKey | OJDXYDGIDJVWTG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |