methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate

C20H15N3O2 — CID 134833852

IUPACmethyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate
SMILESCOC(=O)c1cc(-c2ccccc2)nc2c1ncn2-c1ccccc1
InChIInChI=1S/C20H15N3O2/c1-25-20(24)16-12-17(14-8-4-2-5-9-14)22-19-18(16)21-13-23(19)15-10-6-3-7-11-15/h2-13H,1H3
InChIKeyOJDXYDGIDJVWTG-UHFFFAOYSA-N
MW329.36 g/mol
LogP3.87
Rot. Bonds3

About methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate

methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate (PubChem CID 134833852) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate.

Molecular Properties

Compound Namemethyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate
PubChem CID134833852
Molecular FormulaC20H15N3O2
Molecular Weight329.36 g/mol
Exact Mass329.12
IUPAC Namemethyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate
SMILESCOC(=O)c1cc(-c2ccccc2)nc2c1ncn2-c1ccccc1
InChIInChI=1S/C20H15N3O2/c1-25-20(24)16-12-17(14-8-4-2-5-9-14)22-19-18(16)21-13-23(19)15-10-6-3-7-11-15/h2-13H,1H3
InChIKeyOJDXYDGIDJVWTG-UHFFFAOYSA-N
XLogP3.87
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.36
LogP ≤ 53.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate?
The IUPAC name of methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate (CID 134833852) is methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate.
What is the SMILES notation for methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate?
The canonical SMILES for methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate is COC(=O)c1cc(-c2ccccc2)nc2c1ncn2-c1ccccc1.
What is the InChIKey of methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate?
The InChIKey is OJDXYDGIDJVWTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O2/c1-25-20(24)16-12-17(14-8-4-2-5-9-14)22-19-18(16)21-13-23(19)15-10-6-3-7-11-15/h2-13H,1H3.
What are the key properties of methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate?
methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate has a molecular weight of 329.36 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-diphenylimidazo[4,5-b]pyridine-7-carboxylate is sourced from PubChem (CID 134833852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).