C18H15N3O3S — CID 29090475
methyl 1-cyclopropyl-4-oxo-7-phenyl-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate (PubChem CID 29090475) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is methyl 1-cyclopropyl-4-oxo-7-phenyl-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | methyl 1-cyclopropyl-4-oxo-7-phenyl-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 29090475 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | methyl 1-cyclopropyl-4-oxo-7-phenyl-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)nc2c1c(=O)[nH]c(=S)n2C1CC1 |
| InChI | InChI=1S/C18H15N3O3S/c1-24-17(23)12-9-13(10-5-3-2-4-6-10)19-15-14(12)16(22)20-18(25)21(15)11-7-8-11/h2-6,9,11H,7-8H2,1H3,(H,20,22,25) |
| InChIKey | QNRVBCRPCIWBGJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|