C20H15N3O4S — CID 29091513
methyl 7-(furan-2-yl)-1-(3-methylphenyl)-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate (PubChem CID 29091513) has the molecular formula C20H15N3O4S and a molecular weight of 393.42 g/mol. Its IUPAC name is methyl 7-(furan-2-yl)-1-(3-methylphenyl)-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | methyl 7-(furan-2-yl)-1-(3-methylphenyl)-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 29091513 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | methyl 7-(furan-2-yl)-1-(3-methylphenyl)-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccco2)nc2c1c(=O)[nH]c(=S)n2-c1cccc(C)c1 |
| InChI | InChI=1S/C20H15N3O4S/c1-11-5-3-6-12(9-11)23-17-16(18(24)22-20(23)28)13(19(25)26-2)10-14(21-17)15-7-4-8-27-15/h3-10H,1-2H3,(H,22,24,28) |
| InChIKey | LJMQUVTVODKYAD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|