C22H16N4O2S — CID 10525024
methyl 3-amino-9,11-diphenyl-5-thia-7,8,12-triazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene-4-carboxylate (PubChem CID 10525024) has the molecular formula C22H16N4O2S and a molecular weight of 400.46 g/mol. Its IUPAC name is methyl 3-amino-9,11-diphenyl-5-thia-7,8,12-triazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene-4-carboxylate.
| Compound Name | methyl 3-amino-9,11-diphenyl-5-thia-7,8,12-triazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 10525024 |
| Molecular Formula | C22H16N4O2S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | methyl 3-amino-9,11-diphenyl-5-thia-7,8,12-triazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene-4-carboxylate |
| SMILES | COC(=O)c1sc2nn3c(-c4ccccc4)cc(-c4ccccc4)nc3c2c1N |
| InChI | InChI=1S/C22H16N4O2S/c1-28-22(27)19-18(23)17-20-24-15(13-8-4-2-5-9-13)12-16(14-10-6-3-7-11-14)26(20)25-21(17)29-19/h2-12H,23H2,1H3 |
| InChIKey | JHCDSLZFWRAGMP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |