C30H34O10 — CID 134834079
ethyl 4-(3-ethoxycarbonyl-6-hydroxy-5,7,8-trimethyl-2-oxo-3,4-dihydrochromen-4-yl)-6-hydroxy-5,7,8-trimethyl-2-oxo-3,4-dihydrochromene-3-carboxylate (PubChem CID 134834079) has the molecular formula C30H34O10 and a molecular weight of 554.59 g/mol. Its IUPAC name is ethyl 4-(3-ethoxycarbonyl-6-hydroxy-5,7,8-trimethyl-2-oxo-3,4-dihydrochromen-4-yl)-6-hydroxy-5,7,8-trimethyl-2-oxo-3,4-dihydrochromene-3-carboxylate.
| Compound Name | ethyl 4-(3-ethoxycarbonyl-6-hydroxy-5,7,8-trimethyl-2-oxo-3,4-dihydrochromen-4-yl)-6-hydroxy-5,7,8-trimethyl-2-oxo-3,4-dihydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 134834079 |
| Molecular Formula | C30H34O10 |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | ethyl 4-(3-ethoxycarbonyl-6-hydroxy-5,7,8-trimethyl-2-oxo-3,4-dihydrochromen-4-yl)-6-hydroxy-5,7,8-trimethyl-2-oxo-3,4-dihydrochromene-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)Oc2c(C)c(C)c(O)c(C)c2C1C1c2c(C)c(O)c(C)c(C)c2OC(=O)C1C(=O)OCC |
| InChI | InChI=1S/C30H34O10/c1-9-37-27(33)21-19(17-15(7)23(31)11(3)13(5)25(17)39-29(21)35)20-18-16(8)24(32)12(4)14(6)26(18)40-30(36)22(20)28(34)38-10-2/h19-22,31-32H,9-10H2,1-8H3 |
| InChIKey | ZWLLVVCODWYCBM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|