C14H18O2 — CID 134834847
4'-methylspiro[3,4-dihydrochromene-2,2'-oxane] (PubChem CID 134834847) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 4'-methylspiro[3,4-dihydrochromene-2,2'-oxane].
| Compound Name | 4'-methylspiro[3,4-dihydrochromene-2,2'-oxane] |
|---|---|
| PubChem CID | 134834847 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4'-methylspiro[3,4-dihydrochromene-2,2'-oxane] |
| SMILES | CC1CCOC2(CCc3ccccc3O2)C1 |
| InChI | InChI=1S/C14H18O2/c1-11-7-9-15-14(10-11)8-6-12-4-2-3-5-13(12)16-14/h2-5,11H,6-10H2,1H3 |
| InChIKey | WJTODOUFCMNIRB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |