C18H25NO4S — CID 134834992
ethyl (3aR,7aS)-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole-3a-carboxylate (PubChem CID 134834992) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is ethyl (3aR,7aS)-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole-3a-carboxylate.
| Compound Name | ethyl (3aR,7aS)-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole-3a-carboxylate |
|---|---|
| PubChem CID | 134834992 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | ethyl (3aR,7aS)-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole-3a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCCC[C@@H]1N(S(=O)(=O)c1ccc(C)cc1)CC2 |
| InChI | InChI=1S/C18H25NO4S/c1-3-23-17(20)18-11-5-4-6-16(18)19(13-12-18)24(21,22)15-9-7-14(2)8-10-15/h7-10,16H,3-6,11-13H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | MMCWZGWULKDWLF-FUHWJXTLSA-N |
| XLogP | 2.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |