C26H35NO4Si — CID 134835198
[(2R,3R)-1-benzhydryl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] acetate (PubChem CID 134835198) has the molecular formula C26H35NO4Si and a molecular weight of 453.66 g/mol. Its IUPAC name is [(2R,3R)-1-benzhydryl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [(2R,3R)-1-benzhydryl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 134835198 |
| Molecular Formula | C26H35NO4Si |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | [(2R,3R)-1-benzhydryl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H35NO4Si/c1-18(31-32(6,7)26(3,4)5)22-24(29)27(25(22)30-19(2)28)23(20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-18,22-23,25H,1-7H3/t18-,22+,25-/m1/s1 |
| InChIKey | SPLLNXDQIXYXSU-WSUBETFTSA-N |
| XLogP | 5.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|