C14H19NO6 — CID 134835343
[(5S,6S)-6-acetyloxy-2-ethyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] acetate (PubChem CID 134835343) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is [(5S,6S)-6-acetyloxy-2-ethyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] acetate.
| Compound Name | [(5S,6S)-6-acetyloxy-2-ethyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] acetate |
|---|---|
| PubChem CID | 134835343 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [(5S,6S)-6-acetyloxy-2-ethyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] acetate |
| SMILES | CCN1C(=O)C2C[C@H](OC(C)=O)[C@@H](OC(C)=O)CC2C1=O |
| InChI | InChI=1S/C14H19NO6/c1-4-15-13(18)9-5-11(20-7(2)16)12(21-8(3)17)6-10(9)14(15)19/h9-12H,4-6H2,1-3H3/t9?,10?,11-,12-/m0/s1 |
| InChIKey | QIHJGPHYFJBZHI-QQFIATSDSA-N |
| XLogP | 0.26 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|