C15H21NO7 — CID 166450119
[(5S,6R,7R)-7-acetyloxy-2-ethyl-6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] acetate (PubChem CID 166450119) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is [(5S,6R,7R)-7-acetyloxy-2-ethyl-6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] acetate.
| Compound Name | [(5S,6R,7R)-7-acetyloxy-2-ethyl-6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] acetate |
|---|---|
| PubChem CID | 166450119 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [(5S,6R,7R)-7-acetyloxy-2-ethyl-6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] acetate |
| SMILES | CCN1C(=O)C2C[C@H](OC(C)=O)[C@@H](OC)[C@H](OC(C)=O)C2C1=O |
| InChI | InChI=1S/C15H21NO7/c1-5-16-14(19)9-6-10(22-7(2)17)12(21-4)13(23-8(3)18)11(9)15(16)20/h9-13H,5-6H2,1-4H3/t9?,10-,11?,12+,13+/m0/s1 |
| InChIKey | WSLFVOWGSSGXEC-BEZKJRAVSA-N |
| XLogP | -0.11 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|