C16H23NO6 — CID 156841531
(6-methoxy-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-methylpentanoate (PubChem CID 156841531) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is (6-methoxy-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-methylpentanoate.
| Compound Name | (6-methoxy-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-methylpentanoate |
|---|---|
| PubChem CID | 156841531 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (6-methoxy-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-methylpentanoate |
| SMILES | COC1C(OC(=O)CCC(C)C)C2OC1C1C(=O)N(C)C(=O)C21 |
| InChI | InChI=1S/C16H23NO6/c1-7(2)5-6-8(18)22-14-12-10-9(11(23-12)13(14)21-4)15(19)17(3)16(10)20/h7,9-14H,5-6H2,1-4H3 |
| InChIKey | JTWIUVHFINUTGB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|