C20H24F3NO11 — CID 91291437
4-[3-[(6R,7R)-5-acetyloxy-6-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]propoxy]-4-oxobutanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 91291437) has the molecular formula C20H24F3NO11 and a molecular weight of 511.40 g/mol. Its IUPAC name is 4-[3-[(6R,7R)-5-acetyloxy-6-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]propoxy]-4-oxobutanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[3-[(6R,7R)-5-acetyloxy-6-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]propoxy]-4-oxobutanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 91291437 |
| Molecular Formula | C20H24F3NO11 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 4-[3-[(6R,7R)-5-acetyloxy-6-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]propoxy]-4-oxobutanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)OC1C2O[C@@H](C3C(=O)N(CCCOC(=O)CCC(=O)O)C(=O)C23)[C@H]1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23NO9.C2HF3O2/c1-8-14-12-13(16(28-14)15(8)27-9(2)20)18(25)19(17(12)24)6-3-7-26-11(23)5-4-10(21)22;3-2(4,5)1(6)7/h8,12-16H,3-7H2,1-2H3,(H,21,22);(H,6,7)/t8-,12?,13?,14-,15?,16?;/m1./s1 |
| InChIKey | WWPXYNZJEMODGO-ZMTWKCOZSA-N |
| XLogP | 0.37 |
| TPSA | 173.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|