C20H31NO7 — CID 139041645
2-[(3aR,4R,5S,6R,7S,7aS)-5,6-dihydroxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]ethyl decanoate (PubChem CID 139041645) has the molecular formula C20H31NO7 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[(3aR,4R,5S,6R,7S,7aS)-5,6-dihydroxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]ethyl decanoate.
| Compound Name | 2-[(3aR,4R,5S,6R,7S,7aS)-5,6-dihydroxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]ethyl decanoate |
|---|---|
| PubChem CID | 139041645 |
| Molecular Formula | C20H31NO7 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-[(3aR,4R,5S,6R,7S,7aS)-5,6-dihydroxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]ethyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCCN1C(=O)[C@@H]2[C@@H]3O[C@@H]([C@@H](O)[C@H]3O)[C@@H]2C1=O |
| InChI | InChI=1S/C20H31NO7/c1-2-3-4-5-6-7-8-9-12(22)27-11-10-21-19(25)13-14(20(21)26)18-16(24)15(23)17(13)28-18/h13-18,23-24H,2-11H2,1H3/t13-,14+,15+,16-,17-,18+ |
| InChIKey | GSTDQTLMJVFDED-CKYTUPMTSA-N |
| XLogP | 0.77 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|