C10H11NO6Y-2 — CID 58843023
5,6-dihydroxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-ide-1,3-dione;ethanone;yttrium (PubChem CID 58843023) has the molecular formula C10H11NO6Y-2 and a molecular weight of 330.11 g/mol. Its IUPAC name is 5,6-dihydroxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-ide-1,3-dione;ethanone;yttrium.
| Compound Name | 5,6-dihydroxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-ide-1,3-dione;ethanone;yttrium |
|---|---|
| PubChem CID | 58843023 |
| Molecular Formula | C10H11NO6Y-2 |
| Molecular Weight | 330.11 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 5,6-dihydroxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-ide-1,3-dione;ethanone;yttrium |
| SMILES | C[C-]=O.O=C1[N-]C(=O)C2C3OC(C(O)C3O)C12.[Y] |
| InChI | InChI=1S/C8H9NO5.C2H3O.Y/c10-3-4(11)6-2-1(5(3)14-6)7(12)9-8(2)13;1-2-3;/h1-6,10-11H,(H,9,12,13);1H3;/q;-1;/p-1 |
| InChIKey | FCVNRZFDECPOPE-UHFFFAOYSA-M |
| XLogP | -1.72 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.11 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|