C10H13NO5W — CID 58843017
5-hydroxy-6-methoxy-2-methyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;tungsten (PubChem CID 58843017) has the molecular formula C10H13NO5W and a molecular weight of 411.06 g/mol. Its IUPAC name is 5-hydroxy-6-methoxy-2-methyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;tungsten.
| Compound Name | 5-hydroxy-6-methoxy-2-methyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;tungsten |
|---|---|
| PubChem CID | 58843017 |
| Molecular Formula | C10H13NO5W |
| Molecular Weight | 411.06 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 5-hydroxy-6-methoxy-2-methyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;tungsten |
| SMILES | COC1C(O)C2OC1C1C(=O)N(C)C(=O)C21.[W] |
| InChI | InChI=1S/C10H13NO5.W/c1-11-9(13)3-4(10(11)14)7-8(15-2)5(12)6(3)16-7;/h3-8,12H,1-2H3; |
| InChIKey | APTAKPHLMRMLGX-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.06 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|