C10H11NO7Y-2 — CID 58843020
hydroxymethanone;5-hydroxy-6-methoxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-ide-1,3-dione;yttrium (PubChem CID 58843020) has the molecular formula C10H11NO7Y-2 and a molecular weight of 346.10 g/mol. Its IUPAC name is hydroxymethanone;5-hydroxy-6-methoxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-ide-1,3-dione;yttrium.
| Compound Name | hydroxymethanone;5-hydroxy-6-methoxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-ide-1,3-dione;yttrium |
|---|---|
| PubChem CID | 58843020 |
| Molecular Formula | C10H11NO7Y-2 |
| Molecular Weight | 346.10 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | hydroxymethanone;5-hydroxy-6-methoxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-ide-1,3-dione;yttrium |
| SMILES | COC1C(O)C2OC1C1C(=O)[N-]C(=O)C21.O=[C-]O.[Y] |
| InChI | InChI=1S/C9H11NO5.CHO2.Y/c1-14-7-4(11)5-2-3(6(7)15-5)9(13)10-8(2)12;2-1-3;/h2-7,11H,1H3,(H,10,12,13);(H,2,3);/q;-1;/p-1 |
| InChIKey | LSKQNPIVCURNBV-UHFFFAOYSA-M |
| XLogP | -1.57 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.10 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|