About [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane
[(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane (PubChem CID 134835375) has the molecular formula C21H28Si
and a molecular weight of 308.54 g/mol. Its IUPAC name is [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane.
Molecular Properties
| Compound Name | [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane |
| PubChem CID | 134835375 |
| Molecular Formula | C21H28Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane |
| SMILES | CC[C@@](C)(/C=C\c1ccccc1)C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H28Si/c1-5-21(2,17-16-19-12-8-6-9-13-19)18-22(3,4)20-14-10-7-11-15-20/h6-17H,5,18H2,1-4H3/b17-16-/t21-/m0/s1 |
| InChIKey | WBHITZLVTCKBET-IIUXCQHESA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane?
The IUPAC name of [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane (CID 134835375) is [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane.
What is the SMILES notation for [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane?
The canonical SMILES for [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane is CC[C@@](C)(/C=C\c1ccccc1)C[Si](C)(C)c1ccccc1.
What is the InChIKey of [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane?
The InChIKey is WBHITZLVTCKBET-IIUXCQHESA-N. The full InChI is InChI=1S/C21H28Si/c1-5-21(2,17-16-19-12-8-6-9-13-19)18-22(3,4)20-14-10-7-11-15-20/h6-17H,5,18H2,1-4H3/b17-16-/t21-/m0/s1.
What are the key properties of [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane?
[(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane has a molecular weight of 308.54 g/mol, XLogP of 5.73, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,2S)-2-ethyl-2-methyl-4-phenylbut-3-enyl]-dimethyl-phenylsilane is sourced from PubChem (CID 134835375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).