C23H15NO5 — CID 134835808
(4-benzoyl-2,5-diphenylfuran-3-yl) nitrate (PubChem CID 134835808) has the molecular formula C23H15NO5 and a molecular weight of 385.38 g/mol. Its IUPAC name is (4-benzoyl-2,5-diphenylfuran-3-yl) nitrate.
| Compound Name | (4-benzoyl-2,5-diphenylfuran-3-yl) nitrate |
|---|---|
| PubChem CID | 134835808 |
| Molecular Formula | C23H15NO5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (4-benzoyl-2,5-diphenylfuran-3-yl) nitrate |
| SMILES | O=C(c1ccccc1)c1c(-c2ccccc2)oc(-c2ccccc2)c1O[N+](=O)[O-] |
| InChI | InChI=1S/C23H15NO5/c25-20(16-10-4-1-5-11-16)19-21(17-12-6-2-7-13-17)28-22(23(19)29-24(26)27)18-14-8-3-9-15-18/h1-15H |
| InChIKey | LIVXEEJFKBRWTL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|