C18H16NO2+ — CID 134100012
(2,3-dimethyl-5-phenyl-1,2-oxazol-2-ium-4-yl)-phenylmethanone (PubChem CID 134100012) has the molecular formula C18H16NO2+ and a molecular weight of 278.33 g/mol. Its IUPAC name is (2,3-dimethyl-5-phenyl-1,2-oxazol-2-ium-4-yl)-phenylmethanone.
| Compound Name | (2,3-dimethyl-5-phenyl-1,2-oxazol-2-ium-4-yl)-phenylmethanone |
|---|---|
| PubChem CID | 134100012 |
| Molecular Formula | C18H16NO2+ |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (2,3-dimethyl-5-phenyl-1,2-oxazol-2-ium-4-yl)-phenylmethanone |
| SMILES | Cc1c(C(=O)c2ccccc2)c(-c2ccccc2)o[n+]1C |
| InChI | InChI=1S/C18H16NO2/c1-13-16(17(20)14-9-5-3-6-10-14)18(21-19(13)2)15-11-7-4-8-12-15/h3-12H,1-2H3/q+1 |
| InChIKey | DKIRKVBEEXWEJA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|