C30H50O5Si — CID 134836195
methyl (2E,4E)-6-[(2S,3R,6S,8R)-3-butyl-3-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-9-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-4-methylhexa-2,4-dienoate (PubChem CID 134836195) has the molecular formula C30H50O5Si and a molecular weight of 518.81 g/mol. Its IUPAC name is methyl (2E,4E)-6-[(2S,3R,6S,8R)-3-butyl-3-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-9-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-4-methylhexa-2,4-dienoate.
| Compound Name | methyl (2E,4E)-6-[(2S,3R,6S,8R)-3-butyl-3-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-9-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-4-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 134836195 |
| Molecular Formula | C30H50O5Si |
| Molecular Weight | 518.81 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | methyl (2E,4E)-6-[(2S,3R,6S,8R)-3-butyl-3-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-9-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-4-methylhexa-2,4-dienoate |
| SMILES | C#C[C@@H]1O[C@@]2(CCC(C)[C@@H](C/C=C(C)/C=C/C(=O)OC)O2)CC[C@@]1(CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H50O5Si/c1-11-13-19-29(35-36(9,10)28(5,6)7)21-22-30(34-26(29)12-2)20-18-24(4)25(33-30)16-14-23(3)15-17-27(31)32-8/h2,14-15,17,24-26H,11,13,16,18-22H2,1,3-10H3/b17-15+,23-14+/t24?,25-,26+,29-,30+/m1/s1 |
| InChIKey | PXNVXYABXOKYIO-NIKNLZJISA-N |
| XLogP | 7.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.81 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|