About 9-chloro-1,1-diethoxynon-2-yn-4-one
9-chloro-1,1-diethoxynon-2-yn-4-one (PubChem CID 134836287) has the molecular formula C13H21ClO3
and a molecular weight of 260.76 g/mol. Its IUPAC name is 9-chloro-1,1-diethoxynon-2-yn-4-one.
Molecular Properties
| Compound Name | 9-chloro-1,1-diethoxynon-2-yn-4-one |
| PubChem CID | 134836287 |
| Molecular Formula | C13H21ClO3 |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 9-chloro-1,1-diethoxynon-2-yn-4-one |
| SMILES | CCOC(C#CC(=O)CCCCCCl)OCC |
| InChI | InChI=1S/C13H21ClO3/c1-3-16-13(17-4-2)10-9-12(15)8-6-5-7-11-14/h13H,3-8,11H2,1-2H3 |
| InChIKey | IVAMIDONJBGOCF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-1,1-diethoxynon-2-yn-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-1,1-diethoxynon-2-yn-4-one?
The IUPAC name of 9-chloro-1,1-diethoxynon-2-yn-4-one (CID 134836287) is 9-chloro-1,1-diethoxynon-2-yn-4-one.
What is the SMILES notation for 9-chloro-1,1-diethoxynon-2-yn-4-one?
The canonical SMILES for 9-chloro-1,1-diethoxynon-2-yn-4-one is CCOC(C#CC(=O)CCCCCCl)OCC.
What is the InChIKey of 9-chloro-1,1-diethoxynon-2-yn-4-one?
The InChIKey is IVAMIDONJBGOCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClO3/c1-3-16-13(17-4-2)10-9-12(15)8-6-5-7-11-14/h13H,3-8,11H2,1-2H3.
What are the key properties of 9-chloro-1,1-diethoxynon-2-yn-4-one?
9-chloro-1,1-diethoxynon-2-yn-4-one has a molecular weight of 260.76 g/mol, XLogP of 2.76, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-1,1-diethoxynon-2-yn-4-one is sourced from PubChem (CID 134836287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).