C15H27ClO2 — CID 10707513
11-chloro-1,1-diethoxyundec-2-yne (PubChem CID 10707513) has the molecular formula C15H27ClO2 and a molecular weight of 274.83 g/mol. Its IUPAC name is 11-chloro-1,1-diethoxyundec-2-yne.
| Compound Name | 11-chloro-1,1-diethoxyundec-2-yne |
|---|---|
| PubChem CID | 10707513 |
| Molecular Formula | C15H27ClO2 |
| Molecular Weight | 274.83 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 11-chloro-1,1-diethoxyundec-2-yne |
| SMILES | CCOC(C#CCCCCCCCCCl)OCC |
| InChI | InChI=1S/C15H27ClO2/c1-3-17-15(18-4-2)13-11-9-7-5-6-8-10-12-14-16/h15H,3-10,12,14H2,1-2H3 |
| InChIKey | BZTNLNCATCOKGK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.83 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|