C19H35ClO2 — CID 165174995
11,11-dibutoxy-1-chloroundec-4-yne (PubChem CID 165174995) has the molecular formula C19H35ClO2 and a molecular weight of 330.94 g/mol. Its IUPAC name is 11,11-dibutoxy-1-chloroundec-4-yne.
| Compound Name | 11,11-dibutoxy-1-chloroundec-4-yne |
|---|---|
| PubChem CID | 165174995 |
| Molecular Formula | C19H35ClO2 |
| Molecular Weight | 330.94 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 11,11-dibutoxy-1-chloroundec-4-yne |
| SMILES | CCCCOC(CCCCCC#CCCCCl)OCCCC |
| InChI | InChI=1S/C19H35ClO2/c1-3-5-17-21-19(22-18-6-4-2)15-13-11-9-7-8-10-12-14-16-20/h19H,3-7,9,11-18H2,1-2H3 |
| InChIKey | COMQHYUEGABBAC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.94 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|