C20H34O2 — CID 122444773
14,14-dipropoxytetradeca-3,5-diyne (PubChem CID 122444773) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 14,14-dipropoxytetradeca-3,5-diyne.
| Compound Name | 14,14-dipropoxytetradeca-3,5-diyne |
|---|---|
| PubChem CID | 122444773 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 14,14-dipropoxytetradeca-3,5-diyne |
| SMILES | CCC#CC#CCCCCCCCC(OCCC)OCCC |
| InChI | InChI=1S/C20H34O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-20(21-18-5-2)22-19-6-3/h20H,4-6,11-19H2,1-3H3 |
| InChIKey | GSJKLZWMHVTIRP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|