C10H19NO2 — CID 13066054
4,4-diethoxy-N,N-dimethylbut-2-yn-1-amine (PubChem CID 13066054) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 4,4-diethoxy-N,N-dimethylbut-2-yn-1-amine.
| Compound Name | 4,4-diethoxy-N,N-dimethylbut-2-yn-1-amine |
|---|---|
| PubChem CID | 13066054 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 4,4-diethoxy-N,N-dimethylbut-2-yn-1-amine |
| SMILES | CCOC(C#CCN(C)C)OCC |
| InChI | InChI=1S/C10H19NO2/c1-5-12-10(13-6-2)8-7-9-11(3)4/h10H,5-6,9H2,1-4H3 |
| InChIKey | NBLQWLPNCALCER-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|