C10H16O3 — CID 86671264
6,6-diethoxyhex-4-yn-3-one (PubChem CID 86671264) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 6,6-diethoxyhex-4-yn-3-one.
| Compound Name | 6,6-diethoxyhex-4-yn-3-one |
|---|---|
| PubChem CID | 86671264 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 6,6-diethoxyhex-4-yn-3-one |
| SMILES | CCOC(C#CC(=O)CC)OCC |
| InChI | InChI=1S/C10H16O3/c1-4-9(11)7-8-10(12-5-2)13-6-3/h10H,4-6H2,1-3H3 |
| InChIKey | VMBBWDSWLMNZHY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|