C10H15IO3 — CID 71341214
6,6-diethoxy-2-iodohex-2-en-4-yn-1-ol (PubChem CID 71341214) has the molecular formula C10H15IO3 and a molecular weight of 310.13 g/mol. Its IUPAC name is 6,6-diethoxy-2-iodohex-2-en-4-yn-1-ol.
| Compound Name | 6,6-diethoxy-2-iodohex-2-en-4-yn-1-ol |
|---|---|
| PubChem CID | 71341214 |
| Molecular Formula | C10H15IO3 |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 6,6-diethoxy-2-iodohex-2-en-4-yn-1-ol |
| SMILES | CCOC(C#CC=C(I)CO)OCC |
| InChI | InChI=1S/C10H15IO3/c1-3-13-10(14-4-2)7-5-6-9(11)8-12/h6,10,12H,3-4,8H2,1-2H3 |
| InChIKey | MNQAMJDPVQYTBF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|