C9H13ClO2 — CID 14067290
(E)-1-chloro-5,5-diethoxypent-1-en-3-yne (PubChem CID 14067290) has the molecular formula C9H13ClO2 and a molecular weight of 188.65 g/mol. Its IUPAC name is (E)-1-chloro-5,5-diethoxypent-1-en-3-yne.
| Compound Name | (E)-1-chloro-5,5-diethoxypent-1-en-3-yne |
|---|---|
| PubChem CID | 14067290 |
| Molecular Formula | C9H13ClO2 |
| Molecular Weight | 188.65 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (E)-1-chloro-5,5-diethoxypent-1-en-3-yne |
| SMILES | CCOC(C#C/C=C/Cl)OCC |
| InChI | InChI=1S/C9H13ClO2/c1-3-11-9(12-4-2)7-5-6-8-10/h6,8-9H,3-4H2,1-2H3/b8-6+ |
| InChIKey | PXVOVZJDORSBOT-SOFGYWHQSA-N |
| XLogP | 2.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.65 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|