C13H22O3 — CID 101388649
(E,4S)-1,1-diethoxy-7-methyloct-5-en-2-yn-4-ol (PubChem CID 101388649) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (E,4S)-1,1-diethoxy-7-methyloct-5-en-2-yn-4-ol.
| Compound Name | (E,4S)-1,1-diethoxy-7-methyloct-5-en-2-yn-4-ol |
|---|---|
| PubChem CID | 101388649 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (E,4S)-1,1-diethoxy-7-methyloct-5-en-2-yn-4-ol |
| SMILES | CCOC(C#C[C@@H](O)/C=C/C(C)C)OCC |
| InChI | InChI=1S/C13H22O3/c1-5-15-13(16-6-2)10-9-12(14)8-7-11(3)4/h7-8,11-14H,5-6H2,1-4H3/b8-7+/t12-/m0/s1 |
| InChIKey | KMNZYQWZVFLFFJ-GUOLPTJISA-N |
| XLogP | 1.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|