C18H26N2O3 — CID 134836469
(2S)-2-[(2R,3S)-1-benzoyl-3-propan-2-ylaziridin-2-yl]-N-tert-butyl-2-hydroxyacetamide (PubChem CID 134836469) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2S)-2-[(2R,3S)-1-benzoyl-3-propan-2-ylaziridin-2-yl]-N-tert-butyl-2-hydroxyacetamide.
| Compound Name | (2S)-2-[(2R,3S)-1-benzoyl-3-propan-2-ylaziridin-2-yl]-N-tert-butyl-2-hydroxyacetamide |
|---|---|
| PubChem CID | 134836469 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2S)-2-[(2R,3S)-1-benzoyl-3-propan-2-ylaziridin-2-yl]-N-tert-butyl-2-hydroxyacetamide |
| SMILES | CC(C)[C@H]1[C@H]([C@H](O)C(=O)NC(C)(C)C)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O3/c1-11(2)13-14(15(21)16(22)19-18(3,4)5)20(13)17(23)12-9-7-6-8-10-12/h6-11,13-15,21H,1-5H3,(H,19,22)/t13-,14+,15-,20?/m0/s1 |
| InChIKey | YHNYNJFFQGKMKY-FHNOGEEDSA-N |
| XLogP | 1.81 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|