C19H25NO5 — CID 134837361
benzyl (1S,2R,6R,8R,11S)-4,4,11-trimethyl-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodecane-12-carboxylate (PubChem CID 134837361) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is benzyl (1S,2R,6R,8R,11S)-4,4,11-trimethyl-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodecane-12-carboxylate.
| Compound Name | benzyl (1S,2R,6R,8R,11S)-4,4,11-trimethyl-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodecane-12-carboxylate |
|---|---|
| PubChem CID | 134837361 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | benzyl (1S,2R,6R,8R,11S)-4,4,11-trimethyl-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodecane-12-carboxylate |
| SMILES | C[C@H]1CC[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H25NO5/c1-12-9-10-14-15(16-17(23-14)25-19(2,3)24-16)20(12)18(21)22-11-13-7-5-4-6-8-13/h4-8,12,14-17H,9-11H2,1-3H3/t12-,14+,15-,16+,17+/m0/s1 |
| InChIKey | OPKLJBKLTYIUGV-BMQFZULRSA-N |
| XLogP | 3.05 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |