C14H14F6O2 — CID 134837623
1-[bis(2,2,2-trifluoroethoxy)methyl]-2,3-dihydro-1H-indene (PubChem CID 134837623) has the molecular formula C14H14F6O2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 1-[bis(2,2,2-trifluoroethoxy)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 1-[bis(2,2,2-trifluoroethoxy)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 134837623 |
| Molecular Formula | C14H14F6O2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 1-[bis(2,2,2-trifluoroethoxy)methyl]-2,3-dihydro-1H-indene |
| SMILES | FC(F)(F)COC(OCC(F)(F)F)C1CCc2ccccc21 |
| InChI | InChI=1S/C14H14F6O2/c15-13(16,17)7-21-12(22-8-14(18,19)20)11-6-5-9-3-1-2-4-10(9)11/h1-4,11-12H,5-8H2 |
| InChIKey | BPTGHFRLSMRXLL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|