C14H20O7S — CID 134837659
[(2R,5R)-3,5-dihydroxy-2-methoxy-6-methyloxan-4-yl] 4-methylbenzenesulfonate (PubChem CID 134837659) has the molecular formula C14H20O7S and a molecular weight of 332.37 g/mol. Its IUPAC name is [(2R,5R)-3,5-dihydroxy-2-methoxy-6-methyloxan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,5R)-3,5-dihydroxy-2-methoxy-6-methyloxan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134837659 |
| Molecular Formula | C14H20O7S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [(2R,5R)-3,5-dihydroxy-2-methoxy-6-methyloxan-4-yl] 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1OC(C)[C@@H](O)C(OS(=O)(=O)c2ccc(C)cc2)C1O |
| InChI | InChI=1S/C14H20O7S/c1-8-4-6-10(7-5-8)22(17,18)21-13-11(15)9(2)20-14(19-3)12(13)16/h4-7,9,11-16H,1-3H3/t9?,11-,12?,13?,14-/m1/s1 |
| InChIKey | PTJLVFLIEPWSCT-KVVZAVCNSA-N |
| XLogP | 0.18 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|