C29H28N2O3 — CID 134837721
methyl (10R,13R,14S)-11-benzyl-8-methyl-13-(4-methylphenyl)-12-oxa-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carboxylate (PubChem CID 134837721) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is methyl (10R,13R,14S)-11-benzyl-8-methyl-13-(4-methylphenyl)-12-oxa-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carboxylate.
| Compound Name | methyl (10R,13R,14S)-11-benzyl-8-methyl-13-(4-methylphenyl)-12-oxa-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carboxylate |
|---|---|
| PubChem CID | 134837721 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | methyl (10R,13R,14S)-11-benzyl-8-methyl-13-(4-methylphenyl)-12-oxa-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carboxylate |
| SMILES | COC(=O)[C@@]12Cn3c(c(C)c4ccccc43)[C@@H]1N(Cc1ccccc1)O[C@@H]2c1ccc(C)cc1 |
| InChI | InChI=1S/C29H28N2O3/c1-19-13-15-22(16-14-19)27-29(28(32)33-3)18-30-24-12-8-7-11-23(24)20(2)25(30)26(29)31(34-27)17-21-9-5-4-6-10-21/h4-16,26-27H,17-18H2,1-3H3/t26-,27+,29-/m0/s1 |
| InChIKey | AEIGTOHXRGOLDM-GKRYNVPLSA-N |
| XLogP | 5.66 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|